C12H16ClNO3S — CID 54915093
4-chloro-2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]phenol (PubChem CID 54915093) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 4-chloro-2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 54915093 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-chloro-2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]phenol |
| SMILES | O=S1(=O)CCC(CNCc2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C12H16ClNO3S/c13-11-1-2-12(15)10(5-11)7-14-6-9-3-4-18(16,17)8-9/h1-2,5,9,14-15H,3-4,6-8H2 |
| InChIKey | SLDGKITWTJQAJH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|