C12H17NO4S — CID 60732747
4-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]benzene-1,2-diol (PubChem CID 60732747) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 60732747 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]benzene-1,2-diol |
| SMILES | O=S1(=O)CCC(CNCc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C12H17NO4S/c14-11-2-1-9(5-12(11)15)6-13-7-10-3-4-18(16,17)8-10/h1-2,5,10,13-15H,3-4,6-8H2 |
| InChIKey | PWFAJEHPNLLIBE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|