C10H12N4O2S — CID 117103385
3-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyrimidin-6-amine (PubChem CID 117103385) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyrimidin-6-amine.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 117103385 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyrimidin-6-amine |
| SMILES | Nc1cnc2c(C3CCS(=O)(=O)C3)cnn2c1 |
| InChI | InChI=1S/C10H12N4O2S/c11-8-3-12-10-9(4-13-14(10)5-8)7-1-2-17(15,16)6-7/h3-5,7H,1-2,6,11H2 |
| InChIKey | ZTJPQZUCPAICRO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |