C11H13N3O2S — CID 117131128
2-(1,1-dioxothiolan-3-yl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 117131128) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117131128 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | Nc1cccc2nc(C3CCS(=O)(=O)C3)cn12 |
| InChI | InChI=1S/C11H13N3O2S/c12-10-2-1-3-11-13-9(6-14(10)11)8-4-5-17(15,16)7-8/h1-3,6,8H,4-5,7,12H2 |
| InChIKey | TTYOFMAUTOOKQU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |