C10H10BrN3O2S — CID 117131136
3-(5-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)thiolane 1,1-dioxide (PubChem CID 117131136) has the molecular formula C10H10BrN3O2S and a molecular weight of 316.18 g/mol. Its IUPAC name is 3-(5-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(5-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117131136 |
| Molecular Formula | C10H10BrN3O2S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 3-(5-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc3cccc(Br)n3n2)C1 |
| InChI | InChI=1S/C10H10BrN3O2S/c11-8-2-1-3-9-12-10(13-14(8)9)7-4-5-17(15,16)6-7/h1-3,7H,4-6H2 |
| InChIKey | GKXFAEWARDAPNG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|