C11H14N4 — CID 83866250
2-cyclopentyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 83866250) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-cyclopentyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
| Compound Name | 2-cyclopentyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 83866250 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-cyclopentyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | Nc1cccc2nc(C3CCCC3)nn12 |
| InChI | InChI=1S/C11H14N4/c12-9-6-3-7-10-13-11(14-15(9)10)8-4-1-2-5-8/h3,6-8H,1-2,4-5,12H2 |
| InChIKey | AHVPMQKQDZOUBT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |