C10H12N4 — CID 75481318
2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 75481318) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 75481318 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Nc1ccc2nc(C3CCC3)nn2c1 |
| InChI | InChI=1S/C10H12N4/c11-8-4-5-9-12-10(7-2-1-3-7)13-14(9)6-8/h4-7H,1-3,11H2 |
| InChIKey | NLAZYZDIVNWNJX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |