C10H13FN2O2S — CID 175294684
4-(1,1-dioxothiolan-3-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 175294684) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 175294684 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1ccc(C2CCS(=O)(=O)C2)c(F)c1N |
| InChI | InChI=1S/C10H13FN2O2S/c11-9-7(1-2-8(12)10(9)13)6-3-4-16(14,15)5-6/h1-2,6H,3-5,12-13H2 |
| InChIKey | FRMUAEQLWGGUBZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|