C11H15NO2S — CID 105483189
2-(1,1-dioxothian-4-yl)aniline (PubChem CID 105483189) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)aniline.
| Compound Name | 2-(1,1-dioxothian-4-yl)aniline |
|---|---|
| PubChem CID | 105483189 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)aniline |
| SMILES | Nc1ccccc1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H15NO2S/c12-11-4-2-1-3-10(11)9-5-7-15(13,14)8-6-9/h1-4,9H,5-8,12H2 |
| InChIKey | XTCQMXVNLUHGJR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|