C12H13N3O3S — CID 63903667
2-[5-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 63903667) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[5-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-[5-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 63903667 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[5-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1ccccc1-c1noc(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C12H13N3O3S/c13-10-4-2-1-3-9(10)11-14-12(18-15-11)8-5-6-19(16,17)7-8/h1-4,8H,5-7,13H2 |
| InChIKey | WJQYRXMZWMMPRU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|