C16H15N3O3S — CID 126840136
3-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide (PubChem CID 126840136) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide.
| Compound Name | 3-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 126840136 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(c2nc(-c3nccc4ccccc34)no2)C1 |
| InChI | InChI=1S/C16H15N3O3S/c20-23(21)9-3-5-12(10-23)16-18-15(19-22-16)14-13-6-2-1-4-11(13)7-8-17-14/h1-2,4,6-8,12H,3,5,9-10H2 |
| InChIKey | HQVLTPXWRFCYTD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |