C6H7ClN2O3S — CID 112572058
3-(3-chloro-1,2,4-oxadiazol-5-yl)thiolane 1,1-dioxide (PubChem CID 112572058) has the molecular formula C6H7ClN2O3S and a molecular weight of 222.65 g/mol. Its IUPAC name is 3-(3-chloro-1,2,4-oxadiazol-5-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(3-chloro-1,2,4-oxadiazol-5-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 112572058 |
| Molecular Formula | C6H7ClN2O3S |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 3-(3-chloro-1,2,4-oxadiazol-5-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc(Cl)no2)C1 |
| InChI | InChI=1S/C6H7ClN2O3S/c7-6-8-5(12-9-6)4-1-2-13(10,11)3-4/h4H,1-3H2 |
| InChIKey | RPMZNYQIICQKIF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |