C8H10N2O5S — CID 115045802
5-(1,1-dioxothian-4-yl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 115045802) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is 5-(1,1-dioxothian-4-yl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(1,1-dioxothian-4-yl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115045802 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-(1,1-dioxothian-4-yl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(C2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C8H10N2O5S/c11-8(12)6-9-7(15-10-6)5-1-3-16(13,14)4-2-5/h5H,1-4H2,(H,11,12) |
| InChIKey | YMFUIMUNNZXRFP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |