C7H8N2O4 — CID 63382908
5-(oxolan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63382908) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 5-(oxolan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(oxolan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 63382908 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-(oxolan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(C2CCOC2)n1 |
| InChI | InChI=1S/C7H8N2O4/c10-7(11)5-8-6(13-9-5)4-1-2-12-3-4/h4H,1-3H2,(H,10,11) |
| InChIKey | YPQKMVSHINNJMT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |