C7H11N3O2 — CID 61324587
[5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 61324587) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is [5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]methanamine.
| Compound Name | [5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]methanamine |
|---|---|
| PubChem CID | 61324587 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | [5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | NCc1noc(C2CCOC2)n1 |
| InChI | InChI=1S/C7H11N3O2/c8-3-6-9-7(12-10-6)5-1-2-11-4-5/h5H,1-4,8H2 |
| InChIKey | IXQGHAZLIVYRPS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |