C10H15N3O3 — CID 103971742
3-[5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971742) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 3-[5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971742 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-[5-(oxolan-3-yl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | C1COCC(c2noc(C3CCOC3)n2)N1 |
| InChI | InChI=1S/C10H15N3O3/c1-3-14-5-7(1)10-12-9(13-16-10)8-6-15-4-2-11-8/h7-8,11H,1-6H2 |
| InChIKey | CWZJBZGIOXGLHS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |