C9H15N3O3 — CID 103971477
3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971477) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971477 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | CCOCc1nc(C2COCCN2)no1 |
| InChI | InChI=1S/C9H15N3O3/c1-2-13-6-8-11-9(12-15-8)7-5-14-4-3-10-7/h7,10H,2-6H2,1H3 |
| InChIKey | GRJCXRZZGCLOOJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |