C16H27N3O2 — CID 103971647
3-[5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971647) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 3-[5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971647 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-[5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | CC(C)(C)C1CCC(c2nc(C3COCCN3)no2)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-16(2,3)12-6-4-11(5-7-12)15-18-14(19-21-15)13-10-20-9-8-17-13/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | WKVSQOILUFUKFR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |