C13H22N2O2 — CID 102660490
[5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 102660490) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 102660490 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [5-(4-tert-butylcyclohexyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | CC(C)(C)C1CCC(c2nc(CO)no2)CC1 |
| InChI | InChI=1S/C13H22N2O2/c1-13(2,3)10-6-4-9(5-7-10)12-14-11(8-16)15-17-12/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | KJCLLNCFSRMMBH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |