C10H15N3O2S — CID 103971470
3-[5-(thiolan-2-yl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 103971470) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-[5-(thiolan-2-yl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 3-[5-(thiolan-2-yl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 103971470 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-[5-(thiolan-2-yl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | C1CSC(c2nc(C3COCCN3)no2)C1 |
| InChI | InChI=1S/C10H15N3O2S/c1-2-8(16-5-1)10-12-9(13-15-10)7-6-14-4-3-11-7/h7-8,11H,1-6H2 |
| InChIKey | JKMFUALCZAVWBP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |