C10H17N3O2 — CID 63015287
1-[5-(oxan-3-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 63015287) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[5-(oxan-3-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
| Compound Name | 1-[5-(oxan-3-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 63015287 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-[5-(oxan-3-yl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(N)Cc1noc(C2CCCOC2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(11)5-9-12-10(15-13-9)8-3-2-4-14-6-8/h7-8H,2-6,11H2,1H3 |
| InChIKey | LGNUIMJSFHIABO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |