2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid

C9H11NO4 — CID 63014929

IUPAC2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)c1coc(C2CCCOC2)n1
InChIInChI=1S/C9H11NO4/c11-9(12)7-5-14-8(10-7)6-2-1-3-13-4-6/h5-6H,1-4H2,(H,11,12)
InChIKeyPALZXNXOABTEKO-UHFFFAOYSA-N
MW197.19 g/mol
LogP1.27
Rot. Bonds2

About 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid

2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 63014929) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid
PubChem CID63014929
Molecular FormulaC9H11NO4
Molecular Weight197.19 g/mol
Exact Mass197.07
IUPAC Name2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid
SMILESO=C(O)c1coc(C2CCCOC2)n1
InChIInChI=1S/C9H11NO4/c11-9(12)7-5-14-8(10-7)6-2-1-3-13-4-6/h5-6H,1-4H2,(H,11,12)
InChIKeyPALZXNXOABTEKO-UHFFFAOYSA-N
XLogP1.27
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.19
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid (CID 63014929) is 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid is O=C(O)c1coc(C2CCCOC2)n1.
What is the InChIKey of 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid?
The InChIKey is PALZXNXOABTEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c11-9(12)7-5-14-8(10-7)6-2-1-3-13-4-6/h5-6H,1-4H2,(H,11,12).
What are the key properties of 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid?
2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid has a molecular weight of 197.19 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-3-yl)-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 63014929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).