C8H9NO3 — CID 53399655
2-cyclobutyl-1,3-oxazole-4-carboxylic acid (PubChem CID 53399655) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-cyclobutyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-cyclobutyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53399655 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-cyclobutyl-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(C2CCC2)n1 |
| InChI | InChI=1S/C8H9NO3/c10-8(11)6-4-12-7(9-6)5-2-1-3-5/h4-5H,1-3H2,(H,10,11) |
| InChIKey | BHGYEFGSVNXEME-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |