C11H14N2O4S — CID 167760220
N-cyclobutylsulfonyl-2-cyclopropyl-1,3-oxazole-4-carboxamide (PubChem CID 167760220) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-cyclobutylsulfonyl-2-cyclopropyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-cyclobutylsulfonyl-2-cyclopropyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 167760220 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-cyclobutylsulfonyl-2-cyclopropyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)C1CCC1)c1coc(C2CC2)n1 |
| InChI | InChI=1S/C11H14N2O4S/c14-10(13-18(15,16)8-2-1-3-8)9-6-17-11(12-9)7-4-5-7/h6-8H,1-5H2,(H,13,14) |
| InChIKey | JSBGORRJJQTGQO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |