C11H15NO4S — CID 154841487
N-cyclobutylsulfonyl-2,5-dimethylfuran-3-carboxamide (PubChem CID 154841487) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-cyclobutylsulfonyl-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-cyclobutylsulfonyl-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 154841487 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-cyclobutylsulfonyl-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NS(=O)(=O)C2CCC2)c(C)o1 |
| InChI | InChI=1S/C11H15NO4S/c1-7-6-10(8(2)16-7)11(13)12-17(14,15)9-4-3-5-9/h6,9H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | YRWBIKVNPHDZLE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |