C14H21NO2 — CID 7028594
2,5-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]furan-3-carboxamide (PubChem CID 7028594) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 7028594 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2,5-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2CCCC[C@H]2C)c(C)o1 |
| InChI | InChI=1S/C14H21NO2/c1-9-6-4-5-7-13(9)15-14(16)12-8-10(2)17-11(12)3/h8-9,13H,4-7H2,1-3H3,(H,15,16)/t9-,13-/m1/s1 |
| InChIKey | PGNPRCNLKNZIBC-NOZJJQNGSA-N |
| XLogP | 3.20 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |