C12H18N2O2 — CID 54393495
5-methyl-N-(2-methylcyclohexyl)-1,2-oxazole-4-carboxamide (PubChem CID 54393495) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-methyl-N-(2-methylcyclohexyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-(2-methylcyclohexyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 54393495 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-methyl-N-(2-methylcyclohexyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)NC1CCCCC1C |
| InChI | InChI=1S/C12H18N2O2/c1-8-5-3-4-6-11(8)14-12(15)10-7-13-16-9(10)2/h7-8,11H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | VIHQXWZZBFCHGI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |