C19H23NO2 — CID 138501083
(2-cyclononyl-1,3-oxazol-4-yl)-phenylmethanone (PubChem CID 138501083) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2-cyclononyl-1,3-oxazol-4-yl)-phenylmethanone.
| Compound Name | (2-cyclononyl-1,3-oxazol-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 138501083 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2-cyclononyl-1,3-oxazol-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1coc(C2CCCCCCCC2)n1 |
| InChI | InChI=1S/C19H23NO2/c21-18(15-10-8-5-9-11-15)17-14-22-19(20-17)16-12-6-3-1-2-4-7-13-16/h5,8-11,14,16H,1-4,6-7,12-13H2 |
| InChIKey | FOGMQPNXKZQPDK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |