C17H19N3O3 — CID 90514925
2-benzamido-N-cyclohexyl-1,3-oxazole-4-carboxamide (PubChem CID 90514925) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-benzamido-N-cyclohexyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-benzamido-N-cyclohexyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90514925 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-benzamido-N-cyclohexyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)NC2CCCCC2)co1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O3/c21-15(12-7-3-1-4-8-12)20-17-19-14(11-23-17)16(22)18-13-9-5-2-6-10-13/h1,3-4,7-8,11,13H,2,5-6,9-10H2,(H,18,22)(H,19,20,21) |
| InChIKey | HPARRTFWRHPCQZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |