C17H12BrN3O3 — CID 90514961
2-benzamido-N-(3-bromophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 90514961) has the molecular formula C17H12BrN3O3 and a molecular weight of 386.21 g/mol. Its IUPAC name is 2-benzamido-N-(3-bromophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(3-bromophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90514961 |
| Molecular Formula | C17H12BrN3O3 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-benzamido-N-(3-bromophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)Nc2cccc(Br)c2)co1)c1ccccc1 |
| InChI | InChI=1S/C17H12BrN3O3/c18-12-7-4-8-13(9-12)19-16(23)14-10-24-17(20-14)21-15(22)11-5-2-1-3-6-11/h1-10H,(H,19,23)(H,20,21,22) |
| InChIKey | CCEDYHOFXUTWJG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |