C10H7N3O4 — CID 91669614
2-(pyridine-4-carbonylamino)-1,3-oxazole-4-carboxylic acid (PubChem CID 91669614) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(pyridine-4-carbonylamino)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91669614 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(Nc1nc(C(=O)O)co1)c1ccncc1 |
| InChI | InChI=1S/C10H7N3O4/c14-8(6-1-3-11-4-2-6)13-10-12-7(5-17-10)9(15)16/h1-5H,(H,15,16)(H,12,13,14) |
| InChIKey | GEWAOTZIINQGPQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |