C8H6N4O3 — CID 107588927
2-(pyrimidin-5-ylamino)-1,3-oxazole-4-carboxylic acid (PubChem CID 107588927) has the molecular formula C8H6N4O3 and a molecular weight of 206.16 g/mol. Its IUPAC name is 2-(pyrimidin-5-ylamino)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(pyrimidin-5-ylamino)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107588927 |
| Molecular Formula | C8H6N4O3 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-(pyrimidin-5-ylamino)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(Nc2cncnc2)n1 |
| InChI | InChI=1S/C8H6N4O3/c13-7(14)6-3-15-8(12-6)11-5-1-9-4-10-2-5/h1-4H,(H,11,12)(H,13,14) |
| InChIKey | LVBIPETZDWMDBC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |