C7H9FN2O3 — CID 166178227
2-(3-fluoropropylamino)-1,3-oxazole-4-carboxylic acid (PubChem CID 166178227) has the molecular formula C7H9FN2O3 and a molecular weight of 188.16 g/mol. Its IUPAC name is 2-(3-fluoropropylamino)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(3-fluoropropylamino)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166178227 |
| Molecular Formula | C7H9FN2O3 |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(3-fluoropropylamino)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(NCCCF)n1 |
| InChI | InChI=1S/C7H9FN2O3/c8-2-1-3-9-7-10-5(4-13-7)6(11)12/h4H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | IEMXPRNOVREXCV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|