C8H13N3O5S — CID 106339929
2-[2-(ethylsulfamoyl)ethylamino]-1,3-oxazole-4-carboxylic acid (PubChem CID 106339929) has the molecular formula C8H13N3O5S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[2-(ethylsulfamoyl)ethylamino]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-(ethylsulfamoyl)ethylamino]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106339929 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-[2-(ethylsulfamoyl)ethylamino]-1,3-oxazole-4-carboxylic acid |
| SMILES | CCNS(=O)(=O)CCNc1nc(C(=O)O)co1 |
| InChI | InChI=1S/C8H13N3O5S/c1-2-10-17(14,15)4-3-9-8-11-6(5-16-8)7(12)13/h5,10H,2-4H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | ASNYSBHYOZXEQV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |