C11H10N2O5S — CID 113377106
2-(4-methylsulfonylanilino)-1,3-oxazole-4-carboxylic acid (PubChem CID 113377106) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is 2-(4-methylsulfonylanilino)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4-methylsulfonylanilino)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113377106 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-(4-methylsulfonylanilino)-1,3-oxazole-4-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(Nc2nc(C(=O)O)co2)cc1 |
| InChI | InChI=1S/C11H10N2O5S/c1-19(16,17)8-4-2-7(3-5-8)12-11-13-9(6-18-11)10(14)15/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | QOVVTACGPGSXLH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |