C12H10N2O4S — CID 77089426
6-(4-methylsulfonylphenyl)pyrazine-2-carboxylic acid (PubChem CID 77089426) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 6-(4-methylsulfonylphenyl)pyrazine-2-carboxylic acid.
| Compound Name | 6-(4-methylsulfonylphenyl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 77089426 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-(4-methylsulfonylphenyl)pyrazine-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(C(=O)O)n2)cc1 |
| InChI | InChI=1S/C12H10N2O4S/c1-19(17,18)9-4-2-8(3-5-9)10-6-13-7-11(14-10)12(15)16/h2-7H,1H3,(H,15,16) |
| InChIKey | LMGWUZLTUGWLCL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |