C15H13N3O3S2 — CID 167559020
2-[[6-(4-methylsulfonylphenyl)pyrazin-2-yl]oxymethyl]-1,3-thiazole (PubChem CID 167559020) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[[6-(4-methylsulfonylphenyl)pyrazin-2-yl]oxymethyl]-1,3-thiazole.
| Compound Name | 2-[[6-(4-methylsulfonylphenyl)pyrazin-2-yl]oxymethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 167559020 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[[6-(4-methylsulfonylphenyl)pyrazin-2-yl]oxymethyl]-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(OCc3nccs3)n2)cc1 |
| InChI | InChI=1S/C15H13N3O3S2/c1-23(19,20)12-4-2-11(3-5-12)13-8-16-9-14(18-13)21-10-15-17-6-7-22-15/h2-9H,10H2,1H3 |
| InChIKey | KJPPZCPFQNVVSL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |