C16H18N2O4S — CID 163629142
2-(4-methylsulfonylphenyl)-6-(oxolan-2-ylmethoxy)pyrazine (PubChem CID 163629142) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-6-(oxolan-2-ylmethoxy)pyrazine.
| Compound Name | 2-(4-methylsulfonylphenyl)-6-(oxolan-2-ylmethoxy)pyrazine |
|---|---|
| PubChem CID | 163629142 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-6-(oxolan-2-ylmethoxy)pyrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(OCC3CCCO3)n2)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-23(19,20)14-6-4-12(5-7-14)15-9-17-10-16(18-15)22-11-13-3-2-8-21-13/h4-7,9-10,13H,2-3,8,11H2,1H3 |
| InChIKey | HUOPFLIRTYUORG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |