C15H22N2O5S — CID 95758235
1-[2-(4-methylsulfonylphenoxy)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95758235) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[2-(4-methylsulfonylphenoxy)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[2-(4-methylsulfonylphenoxy)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95758235 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[2-(4-methylsulfonylphenoxy)ethyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | CS(=O)(=O)c1ccc(OCCNC(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-23(19,20)14-6-4-12(5-7-14)22-10-8-16-15(18)17-11-13-3-2-9-21-13/h4-7,13H,2-3,8-11H2,1H3,(H2,16,17,18)/t13-/m0/s1 |
| InChIKey | IJLMOUNYZWSKJK-ZDUSSCGKSA-N |
| XLogP | 0.95 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|