C17H26N2O3 — CID 112974257
1-(oxolan-2-ylmethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea (PubChem CID 112974257) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112974257 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[2-(2,3,6-trimethylphenoxy)ethyl]urea |
| SMILES | Cc1ccc(C)c(OCCNC(=O)NCC2CCCO2)c1C |
| InChI | InChI=1S/C17H26N2O3/c1-12-6-7-13(2)16(14(12)3)22-10-8-18-17(20)19-11-15-5-4-9-21-15/h6-7,15H,4-5,8-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | BQMRGBIOUFBZHK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|