C16H22FN3O3 — CID 95158538
2-(4-fluorophenyl)-N-[2-[[(2S)-oxolan-2-yl]methylcarbamoylamino]ethyl]acetamide (PubChem CID 95158538) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[(2S)-oxolan-2-yl]methylcarbamoylamino]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[(2S)-oxolan-2-yl]methylcarbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 95158538 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[(2S)-oxolan-2-yl]methylcarbamoylamino]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NCCNC(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H22FN3O3/c17-13-5-3-12(4-6-13)10-15(21)18-7-8-19-16(22)20-11-14-2-1-9-23-14/h3-6,14H,1-2,7-11H2,(H,18,21)(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | JPJRMCGADALIHE-AWEZNQCLSA-N |
| XLogP | 0.96 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|