C16H22N3O3S — CID 156650386
CID 156650386 (PubChem CID 156650386) has the molecular formula C16H22N3O3S and a molecular weight of 336.44 g/mol.
| Compound Name | CID 156650386 |
|---|---|
| PubChem CID | 156650386 |
| Molecular Formula | C16H22N3O3S |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)c1ccc(C2=NC(NC[C@H]3CCCO3)=CN[CH]2)cc1.[H][H] |
| InChI | InChI=1S/C16H20N3O3S.H2/c1-23(20,21)14-6-4-12(5-7-14)15-10-17-11-16(19-15)18-9-13-3-2-8-22-13;/h4-7,10-11,13,17-18H,2-3,8-9H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | QGHRVMGOLGLGNT-BTQNPOSSSA-N |
| XLogP | 1.46 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |