C19H29N2O3S+ — CID 156650271
1-ethyl-2-(4-methylsulfonylphenyl)-N-(oxolan-2-ylmethyl)-2,3,4,5-tetrahydropyridin-1-ium-6-amine (PubChem CID 156650271) has the molecular formula C19H29N2O3S+ and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-ethyl-2-(4-methylsulfonylphenyl)-N-(oxolan-2-ylmethyl)-2,3,4,5-tetrahydropyridin-1-ium-6-amine.
| Compound Name | 1-ethyl-2-(4-methylsulfonylphenyl)-N-(oxolan-2-ylmethyl)-2,3,4,5-tetrahydropyridin-1-ium-6-amine |
|---|---|
| PubChem CID | 156650271 |
| Molecular Formula | C19H29N2O3S+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-ethyl-2-(4-methylsulfonylphenyl)-N-(oxolan-2-ylmethyl)-2,3,4,5-tetrahydropyridin-1-ium-6-amine |
| SMILES | CC[N+]1=C(NCC2CCCO2)CCCC1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-3-21-18(15-9-11-17(12-10-15)25(2,22)23)7-4-8-19(21)20-14-16-6-5-13-24-16/h9-12,16,18H,3-8,13-14H2,1-2H3/p+1 |
| InChIKey | KBTOWQBYEWCUGX-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|