C14H18O5S — CID 59331329
2-(4-methylsulfonylphenyl)-3-(oxolan-2-yl)propanoic acid (PubChem CID 59331329) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-(oxolan-2-yl)propanoic acid.
| Compound Name | 2-(4-methylsulfonylphenyl)-3-(oxolan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 59331329 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-(oxolan-2-yl)propanoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CCCO2)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18O5S/c1-20(17,18)12-6-4-10(5-7-12)13(14(15)16)9-11-3-2-8-19-11/h4-7,11,13H,2-3,8-9H2,1H3,(H,15,16) |
| InChIKey | AMNLRPRMQPZIBO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |