2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid

C14H16Cl2O3 — CID 142974376

IUPAC2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid
SMILESO=C(O)C(CC1CCCCO1)c1ccc(Cl)cc1Cl
InChIInChI=1S/C14H16Cl2O3/c15-9-4-5-11(13(16)7-9)12(14(17)18)8-10-3-1-2-6-19-10/h4-5,7,10,12H,1-3,6,8H2,(H,17,18)
InChIKeyNUFCTLGVVNZKLF-UHFFFAOYSA-N
MW303.18 g/mol
LogP4.12
Rot. Bonds4

About 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid

2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid (PubChem CID 142974376) has the molecular formula C14H16Cl2O3 and a molecular weight of 303.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid.

Molecular Properties

Compound Name2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid
PubChem CID142974376
Molecular FormulaC14H16Cl2O3
Molecular Weight303.18 g/mol
Exact Mass302.05
IUPAC Name2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid
SMILESO=C(O)C(CC1CCCCO1)c1ccc(Cl)cc1Cl
InChIInChI=1S/C14H16Cl2O3/c15-9-4-5-11(13(16)7-9)12(14(17)18)8-10-3-1-2-6-19-10/h4-5,7,10,12H,1-3,6,8H2,(H,17,18)
InChIKeyNUFCTLGVVNZKLF-UHFFFAOYSA-N
XLogP4.12
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.18
LogP ≤ 54.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid?
The IUPAC name of 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid (CID 142974376) is 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid?
The canonical SMILES for 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid is O=C(O)C(CC1CCCCO1)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid?
The InChIKey is NUFCTLGVVNZKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2O3/c15-9-4-5-11(13(16)7-9)12(14(17)18)8-10-3-1-2-6-19-10/h4-5,7,10,12H,1-3,6,8H2,(H,17,18).
What are the key properties of 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid?
2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid has a molecular weight of 303.18 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-3-(oxan-2-yl)propanoic acid is sourced from PubChem (CID 142974376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).