C15H14N4O2S2 — CID 167562711
6-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-ylmethyl)pyrazin-2-amine (PubChem CID 167562711) has the molecular formula C15H14N4O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 6-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-ylmethyl)pyrazin-2-amine.
| Compound Name | 6-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 167562711 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 6-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-ylmethyl)pyrazin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(NCc3nccs3)n2)cc1 |
| InChI | InChI=1S/C15H14N4O2S2/c1-23(20,21)12-4-2-11(3-5-12)13-8-16-9-14(19-13)18-10-15-17-6-7-22-15/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | JCFIOMAOCVOFDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |