C19H17FN2O2S — CID 167640304
2-[2-(4-fluorophenyl)ethyl]-6-(4-methylsulfonylphenyl)pyrazine (PubChem CID 167640304) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-6-(4-methylsulfonylphenyl)pyrazine.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-6-(4-methylsulfonylphenyl)pyrazine |
|---|---|
| PubChem CID | 167640304 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-6-(4-methylsulfonylphenyl)pyrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(CCc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H17FN2O2S/c1-25(23,24)18-10-5-15(6-11-18)19-13-21-12-17(22-19)9-4-14-2-7-16(20)8-3-14/h2-3,5-8,10-13H,4,9H2,1H3 |
| InChIKey | PBOHIXSYBFZIQT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |