C16H12FNO2S2 — CID 54094069
2-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-1,3-thiazole (PubChem CID 54094069) has the molecular formula C16H12FNO2S2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 54094069 |
| Molecular Formula | C16H12FNO2S2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C16H12FNO2S2/c1-22(19,20)14-8-4-11(5-9-14)15-10-18-16(21-15)12-2-6-13(17)7-3-12/h2-10H,1H3 |
| InChIKey | MVVVWCYEUDOKJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |