C11H10N2O3S2 — CID 141096444
2-(4-methylsulfonylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 141096444) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-methylsulfonylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141096444 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ncc(C(N)=O)s2)cc1 |
| InChI | InChI=1S/C11H10N2O3S2/c1-18(15,16)8-4-2-7(3-5-8)11-13-6-9(17-11)10(12)14/h2-6H,1H3,(H2,12,14) |
| InChIKey | KXKRKDRUYDBSBK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |