C8H6N2OS2 — CID 130667272
2-thiophen-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 130667272) has the molecular formula C8H6N2OS2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130667272 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(-c2cccs2)s1 |
| InChI | InChI=1S/C8H6N2OS2/c9-7(11)6-4-10-8(13-6)5-2-1-3-12-5/h1-4H,(H2,9,11) |
| InChIKey | CJVYAUJUDHVUCT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |